C21H26Cl2N2O2 — CID 98301308
(5S,7S)-3-acetamido-N-[(2,3-dichlorophenyl)methyl]-N-methyladamantane-1-carboxamide (PubChem CID 98301308) has the molecular formula C21H26Cl2N2O2 and a molecular weight of 409.36 g/mol. Its IUPAC name is (5S,7S)-3-acetamido-N-[(2,3-dichlorophenyl)methyl]-N-methyladamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-acetamido-N-[(2,3-dichlorophenyl)methyl]-N-methyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 98301308 |
| Molecular Formula | C21H26Cl2N2O2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (5S,7S)-3-acetamido-N-[(2,3-dichlorophenyl)methyl]-N-methyladamantane-1-carboxamide |
| SMILES | CC(=O)NC12C[C@H]3C[C@H](C1)CC(C(=O)N(C)Cc1cccc(Cl)c1Cl)(C3)C2 |
| InChI | InChI=1S/C21H26Cl2N2O2/c1-13(26)24-21-9-14-6-15(10-21)8-20(7-14,12-21)19(27)25(2)11-16-4-3-5-17(22)18(16)23/h3-5,14-15H,6-12H2,1-2H3,(H,24,26)/t14-,15-,20?,21?/m0/s1 |
| InChIKey | QKTGXUACUXWZQU-LDSOLPTJSA-N |
| XLogP | 4.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |