C23H25FN4O — CID 98282069
(6R)-3-(4-fluorophenyl)-6-hexyl-6-methyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one (PubChem CID 98282069) has the molecular formula C23H25FN4O and a molecular weight of 392.48 g/mol. Its IUPAC name is (6R)-3-(4-fluorophenyl)-6-hexyl-6-methyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one.
| Compound Name | (6R)-3-(4-fluorophenyl)-6-hexyl-6-methyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one |
|---|---|
| PubChem CID | 98282069 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (6R)-3-(4-fluorophenyl)-6-hexyl-6-methyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one |
| SMILES | CCCCCC[C@]1(C)Nc2ccccc2-c2nc(=O)c(-c3ccc(F)cc3)nn21 |
| InChI | InChI=1S/C23H25FN4O/c1-3-4-5-8-15-23(2)26-19-10-7-6-9-18(19)21-25-22(29)20(27-28(21)23)16-11-13-17(24)14-12-16/h6-7,9-14,26H,3-5,8,15H2,1-2H3/t23-/m1/s1 |
| InChIKey | FWNULQKBTRUWOP-HSZRJFAPSA-N |
| XLogP | 5.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|