C19H22N2O6 — CID 98284254
(4-carbamoyl-2-nitrophenyl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate (PubChem CID 98284254) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is (4-carbamoyl-2-nitrophenyl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate.
| Compound Name | (4-carbamoyl-2-nitrophenyl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98284254 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (4-carbamoyl-2-nitrophenyl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate |
| SMILES | NC(=O)c1ccc(COC(=O)C23C[C@H]4C[C@@H](CC(O)(C4)C2)C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H22N2O6/c20-16(22)13-1-2-14(15(4-13)21(25)26)9-27-17(23)18-5-11-3-12(6-18)8-19(24,7-11)10-18/h1-2,4,11-12,24H,3,5-10H2,(H2,20,22)/t11-,12-,18?,19?/m1/s1 |
| InChIKey | OJCWFRNZTPJACI-TYGXQLQZSA-N |
| XLogP | 2.07 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|