C20H24N2O7 — CID 98284682
[2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 98284682) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 98284682 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](NC(=O)COC(=O)c1cc3c(cc1[N+](=O)[O-])OCO3)C2 |
| InChI | InChI=1S/C20H24N2O7/c1-19(2)11-4-5-20(19,3)16(6-11)21-17(23)9-27-18(24)12-7-14-15(29-10-28-14)8-13(12)22(25)26/h7-8,11,16H,4-6,9-10H2,1-3H3,(H,21,23)/t11-,16+,20-/m0/s1 |
| InChIKey | XZMFSGAQVLGXAZ-RBOBLBHYSA-N |
| XLogP | 2.81 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|