C17H15N7O2 — CID 98296626
(4R)-4-cyano-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-oxo-1,4-dihydropyrazole-3-carboxamide (PubChem CID 98296626) has the molecular formula C17H15N7O2 and a molecular weight of 349.35 g/mol. Its IUPAC name is (4R)-4-cyano-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-oxo-1,4-dihydropyrazole-3-carboxamide.
| Compound Name | (4R)-4-cyano-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-oxo-1,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98296626 |
| Molecular Formula | C17H15N7O2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (4R)-4-cyano-N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-oxo-1,4-dihydropyrazole-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=N\NC(=O)C1=NNC(=O)[C@H]1C#N |
| InChI | InChI=1S/C17H15N7O2/c1-10-14(11(2)24(23-10)12-6-4-3-5-7-12)9-19-21-17(26)15-13(8-18)16(25)22-20-15/h3-7,9,13H,1-2H3,(H,21,26)(H,22,25)/b19-9-/t13-/m0/s1 |
| InChIKey | XRCPBJNBDHVGNK-ATDWHHCWSA-N |
| XLogP | 0.56 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|