C26H24Cl3N5OS — CID 98298230
(Z)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]carbamothioylamino]ethyl]prop-2-enamide (PubChem CID 98298230) has the molecular formula C26H24Cl3N5OS and a molecular weight of 560.94 g/mol. Its IUPAC name is (Z)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]carbamothioylamino]ethyl]prop-2-enamide.
| Compound Name | (Z)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]carbamothioylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 98298230 |
| Molecular Formula | C26H24Cl3N5OS |
| Molecular Weight | 560.94 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | (Z)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]carbamothioylamino]ethyl]prop-2-enamide |
| SMILES | Cc1ccccc1/N=N/c1ccc(NC(=S)N[C@@H](NC(=O)/C=C\c2ccccc2)C(Cl)(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C26H24Cl3N5OS/c1-17-8-6-7-11-22(17)34-33-20-13-14-21(18(2)16-20)30-25(36)32-24(26(27,28)29)31-23(35)15-12-19-9-4-3-5-10-19/h3-16,24H,1-2H3,(H,31,35)(H2,30,32,36)/b15-12-,34-33+/t24-/m1/s1 |
| InChIKey | MZIGKIGNTLXAOD-YVGZHCKTSA-N |
| XLogP | 7.53 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.94 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|