C23H27ClN2O3 — CID 98351981
2-chloro-N-cyclohexyl-5-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylbenzamide (PubChem CID 98351981) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylbenzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 98351981 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(N2C(=O)[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]3C2=O)ccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-25(15-5-3-2-4-6-15)21(27)17-12-16(9-10-18(17)24)26-22(28)19-13-7-8-14(11-13)20(19)23(26)29/h9-10,12-15,19-20H,2-8,11H2,1H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | AJPPFZYYCSRQOF-WZBLMQSHSA-N |
| XLogP | 4.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|