C14H8N2O5 — CID 98368735
(3S)-3-(2-hydroxy-5-nitroanilino)-6,7-didehydro-3H-2-benzofuran-1-one (PubChem CID 98368735) has the molecular formula C14H8N2O5 and a molecular weight of 284.23 g/mol. Its IUPAC name is (3S)-3-(2-hydroxy-5-nitroanilino)-6,7-didehydro-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-(2-hydroxy-5-nitroanilino)-6,7-didehydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 98368735 |
| Molecular Formula | C14H8N2O5 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (3S)-3-(2-hydroxy-5-nitroanilino)-6,7-didehydro-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@H](Nc2cc([N+](=O)[O-])ccc2O)c2ccc#cc21 |
| InChI | InChI=1S/C14H8N2O5/c17-12-6-5-8(16(19)20)7-11(12)15-13-9-3-1-2-4-10(9)14(18)21-13/h1,3,5-7,13,15,17H/t13-/m0/s1 |
| InChIKey | FOCZTLAHHGKDGC-ZDUSSCGKSA-N |
| XLogP | 2.18 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|