C21H16ClFN4O4S2 — CID 98394689
N-(3-chlorophenyl)-4-[(2E)-2-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 98394689) has the molecular formula C21H16ClFN4O4S2 and a molecular weight of 506.97 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(2E)-2-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-4-[(2E)-2-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 98394689 |
| Molecular Formula | C21H16ClFN4O4S2 |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(2E)-2-(6-fluoro-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1N/N=C1\CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C21H16ClFN4O4S2/c22-13-2-1-3-15(10-13)26-33(30,31)16-5-6-19(20(12-16)27(28)29)25-24-18-8-9-32-21-7-4-14(23)11-17(18)21/h1-7,10-12,25-26H,8-9H2/b24-18+ |
| InChIKey | AJWUCGREFUXRHE-HKOYGPOVSA-N |
| XLogP | 5.50 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|