C22H17FN4O8S2 — CID 42912387
2-[[4-[(2E)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 42912387) has the molecular formula C22H17FN4O8S2 and a molecular weight of 548.53 g/mol. Its IUPAC name is 2-[[4-[(2E)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[(2E)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 42912387 |
| Molecular Formula | C22H17FN4O8S2 |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 2-[[4-[(2E)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccc(N/N=C2\CCS(=O)(=O)c3ccc(F)cc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17FN4O8S2/c23-13-5-8-21-16(11-13)17(9-10-36(21,32)33)24-25-19-7-6-14(12-20(19)27(30)31)37(34,35)26-18-4-2-1-3-15(18)22(28)29/h1-8,11-12,25-26H,9-10H2,(H,28,29)/b24-17+ |
| InChIKey | WAKBSQZXJFXUOF-JJIBRWJFSA-N |
| XLogP | 3.23 |
| TPSA | 185.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|