C23H21FN4O6S2 — CID 6153876
N-(2,4-dimethylphenyl)-2-[(2Z)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 6153876) has the molecular formula C23H21FN4O6S2 and a molecular weight of 532.58 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(2Z)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(2Z)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6153876 |
| Molecular Formula | C23H21FN4O6S2 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(2Z)-2-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C2/CCS(=O)(=O)c3ccc(F)cc32)c(C)c1 |
| InChI | InChI=1S/C23H21FN4O6S2/c1-14-3-6-19(15(2)11-14)27-36(33,34)23-13-17(28(29)30)5-7-21(23)26-25-20-9-10-35(31,32)22-8-4-16(24)12-18(20)22/h3-8,11-13,26-27H,9-10H2,1-2H3/b25-20- |
| InChIKey | INJOIKWLTCGAPO-QQTULTPQSA-N |
| XLogP | 4.15 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|