C15H12ClN3O2S — CID 2741143
N-[(6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]-4-nitroaniline (PubChem CID 2741143) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is N-[(6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]-4-nitroaniline.
| Compound Name | N-[(6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]-4-nitroaniline |
|---|---|
| PubChem CID | 2741143 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[(6-chloro-2,3-dihydrothiochromen-4-ylidene)amino]-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NN=C2CCSc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H12ClN3O2S/c16-10-1-6-15-13(9-10)14(7-8-22-15)18-17-11-2-4-12(5-3-11)19(20)21/h1-6,9,17H,7-8H2 |
| InChIKey | NRYWTZDTRZUYFI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|