C27H33N5O6S — CID 98398561
N-[(6S)-6-methyl-2-nonyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-3,5-dinitrobenzamide (PubChem CID 98398561) has the molecular formula C27H33N5O6S and a molecular weight of 555.66 g/mol. Its IUPAC name is N-[(6S)-6-methyl-2-nonyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(6S)-6-methyl-2-nonyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 98398561 |
| Molecular Formula | C27H33N5O6S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | N-[(6S)-6-methyl-2-nonyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-3,5-dinitrobenzamide |
| SMILES | CCCCCCCCCc1nc2sc3c(c2c(=O)n1NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C[C@@H](C)CC3 |
| InChI | InChI=1S/C27H33N5O6S/c1-3-4-5-6-7-8-9-10-23-28-26-24(21-13-17(2)11-12-22(21)39-26)27(34)30(23)29-25(33)18-14-19(31(35)36)16-20(15-18)32(37)38/h14-17H,3-13H2,1-2H3,(H,29,33)/t17-/m0/s1 |
| InChIKey | YNMOOKQFMWSWJP-KRWDZBQOSA-N |
| XLogP | 6.08 |
| TPSA | 150.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|