C23H29Cl2N3O — CID 98401902
1-[(2,6-dichlorophenyl)methyl]-3,5-dimethyl-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrazole-4-carboxamide (PubChem CID 98401902) has the molecular formula C23H29Cl2N3O and a molecular weight of 434.41 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-3,5-dimethyl-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-3,5-dimethyl-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 98401902 |
| Molecular Formula | C23H29Cl2N3O |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-3,5-dimethyl-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1C(=O)N[C@@H]1C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C23H29Cl2N3O/c1-13-20(14(2)28(27-13)12-16-17(24)7-6-8-18(16)25)21(29)26-19-11-15-9-10-23(19,5)22(15,3)4/h6-8,15,19H,9-12H2,1-5H3,(H,26,29)/t15-,19+,23-/m0/s1 |
| InChIKey | UVWGKYLODFTVNF-YWBKXGLFSA-N |
| XLogP | 5.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |