C19H32ClN3OS — CID 98430993
1-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 98430993) has the molecular formula C19H32ClN3OS and a molecular weight of 386.01 g/mol. Its IUPAC name is 1-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 98430993 |
| Molecular Formula | C19H32ClN3OS |
| Molecular Weight | 386.01 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[[(5R,7R)-3-chloro-1-adamantyl]methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | S=C(NCCCN1CCOCC1)NCC12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C19H32ClN3OS/c20-19-11-15-8-16(12-19)10-18(9-15,13-19)14-22-17(25)21-2-1-3-23-4-6-24-7-5-23/h15-16H,1-14H2,(H2,21,22,25)/t15-,16-,18?,19?/m1/s1 |
| InChIKey | MCRMGQVLNHHPSR-FDCMFXBMSA-N |
| XLogP | 2.75 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.01 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|