C15H24N2O4 — CID 98452626
(1R,4S,5R,8S,9R,12R,13S)-11-amino-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 98452626) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,12R,13S)-11-amino-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,9R,12R,13S)-11-amino-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 98452626 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (1R,4S,5R,8S,9R,12R,13S)-11-amino-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(N)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]23OO4 |
| InChI | InChI=1S/C15H24N2O4/c1-8-4-5-11-9(2)12(18)17(16)13-15(11)10(8)6-7-14(3,19-13)20-21-15/h8-11,13H,4-7,16H2,1-3H3/t8-,9-,10+,11+,13-,14-,15+/m1/s1 |
| InChIKey | SDPLWYWNQUROTR-GZEPNZDPSA-N |
| XLogP | 1.55 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|