C24H31NO5 — CID 10093163
(1S,5S,6R,9S,10R,13R,14R)-1,6,10-trimethyl-12-phenacyl-15,16,17-trioxa-12-azatetracyclo[11.3.1.05,14.09,14]heptadecan-11-one (PubChem CID 10093163) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (1S,5S,6R,9S,10R,13R,14R)-1,6,10-trimethyl-12-phenacyl-15,16,17-trioxa-12-azatetracyclo[11.3.1.05,14.09,14]heptadecan-11-one.
| Compound Name | (1S,5S,6R,9S,10R,13R,14R)-1,6,10-trimethyl-12-phenacyl-15,16,17-trioxa-12-azatetracyclo[11.3.1.05,14.09,14]heptadecan-11-one |
|---|---|
| PubChem CID | 10093163 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (1S,5S,6R,9S,10R,13R,14R)-1,6,10-trimethyl-12-phenacyl-15,16,17-trioxa-12-azatetracyclo[11.3.1.05,14.09,14]heptadecan-11-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(CC(=O)c3ccccc3)[C@@H]3O[C@]4(C)CCC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C24H31NO5/c1-15-11-12-19-16(2)21(27)25(14-20(26)17-8-5-4-6-9-17)22-24(19)18(15)10-7-13-23(3,28-22)29-30-24/h4-6,8-9,15-16,18-19,22H,7,10-14H2,1-3H3/t15-,16-,18+,19+,22-,23+,24-/m1/s1 |
| InChIKey | KOUCVLZWIAJYLU-LLCVMEIISA-N |
| XLogP | 3.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|