C32H55N3O6 — CID 86577162
N-tert-butyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]-3-[(5S,9R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanamide (PubChem CID 86577162) has the molecular formula C32H55N3O6 and a molecular weight of 577.81 g/mol. Its IUPAC name is N-tert-butyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]-3-[(5S,9R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanamide.
| Compound Name | N-tert-butyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]-3-[(5S,9R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanamide |
|---|---|
| PubChem CID | 86577162 |
| Molecular Formula | C32H55N3O6 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.41 |
| IUPAC Name | N-tert-butyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]-3-[(5S,9R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanamide |
| SMILES | C[C@H]1CCC2[C@@H](C)C(=O)N(CCC(=O)N(CC(=O)NC(C)(C)CC(C)(C)C)C(C)(C)C)C3OC4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C32H55N3O6/c1-20-12-13-23-21(2)26(38)34(27-32(23)22(20)14-16-31(11,39-27)40-41-32)17-15-25(37)35(29(6,7)8)18-24(36)33-30(9,10)19-28(3,4)5/h20-23,27H,12-19H2,1-11H3,(H,33,36)/t20-,21+,22?,23?,27?,31?,32+/m0/s1 |
| InChIKey | XUKKOVJXJPDEGO-FBUOVEBDSA-N |
| XLogP | 5.03 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|