C31H43N3O7 — CID 171347784
N-[2-[tert-butyl-[3-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanoyl]amino]acetyl]benzamide (PubChem CID 171347784) has the molecular formula C31H43N3O7 and a molecular weight of 569.70 g/mol. Its IUPAC name is N-[2-[tert-butyl-[3-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanoyl]amino]acetyl]benzamide.
| Compound Name | N-[2-[tert-butyl-[3-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanoyl]amino]acetyl]benzamide |
|---|---|
| PubChem CID | 171347784 |
| Molecular Formula | C31H43N3O7 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | N-[2-[tert-butyl-[3-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]propanoyl]amino]acetyl]benzamide |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(CCC(=O)N(CC(=O)NC(=O)c3ccccc3)C(C)(C)C)[C@@H]3O[C@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C31H43N3O7/c1-19-12-13-23-20(2)27(38)33(28-31(23)22(19)14-16-30(6,39-28)40-41-31)17-15-25(36)34(29(3,4)5)18-24(35)32-26(37)21-10-8-7-9-11-21/h7-11,19-20,22-23,28H,12-18H2,1-6H3,(H,32,35,37)/t19-,20-,22+,23+,28-,30+,31-/m1/s1 |
| InChIKey | OKFAWCAMOBPNEU-XSUVWDJCSA-N |
| XLogP | 3.65 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|