C19H25NO4S — CID 118718557
(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-thiophen-2-yl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 118718557) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-thiophen-2-yl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-thiophen-2-yl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 118718557 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-thiophen-2-yl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(c3cccs3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C19H25NO4S/c1-11-6-7-14-12(2)16(21)20(15-5-4-10-25-15)17-19(14)13(11)8-9-18(3,22-17)23-24-19/h4-5,10-14,17H,6-9H2,1-3H3/t11-,12-,13+,14+,17-,18-,19-/m1/s1 |
| InChIKey | PJBPRSMZQDWWIQ-CDRIZAFTSA-N |
| XLogP | 3.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|