C3H6N4 — CID 98452860
(4R)-4H-pyrazole-3,4-diamine (PubChem CID 98452860) has the molecular formula C3H6N4 and a molecular weight of 98.11 g/mol. Its IUPAC name is (4R)-4H-pyrazole-3,4-diamine.
| Compound Name | (4R)-4H-pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 98452860 |
| Molecular Formula | C3H6N4 |
| Molecular Weight | 98.11 g/mol |
| Exact Mass | 98.06 |
| IUPAC Name | (4R)-4H-pyrazole-3,4-diamine |
| SMILES | NC1=NN=C[C@H]1N |
| InChI | InChI=1S/C3H6N4/c4-2-1-6-7-3(2)5/h1-2H,4H2,(H2,5,7)/t2-/m1/s1 |
| InChIKey | SUKMEDQSBROCRB-UWTATZPHSA-N |
| XLogP | -1.33 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.11 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |