C5H10N2 — CID 57259265
3-methyl-3,4-dihydro-2H-pyrrol-4-amine (PubChem CID 57259265) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is 3-methyl-3,4-dihydro-2H-pyrrol-4-amine.
| Compound Name | 3-methyl-3,4-dihydro-2H-pyrrol-4-amine |
|---|---|
| PubChem CID | 57259265 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 3-methyl-3,4-dihydro-2H-pyrrol-4-amine |
| SMILES | CC1CN=CC1N |
| InChI | InChI=1S/C5H10N2/c1-4-2-7-3-5(4)6/h3-5H,2,6H2,1H3 |
| InChIKey | CGIZYXJROKHFKH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |