C4H16Br4N4 — CID 12509581
cyclobutane-1,2,3,4-tetramine;tetrahydrobromide (PubChem CID 12509581) has the molecular formula C4H16Br4N4 and a molecular weight of 439.82 g/mol. Its IUPAC name is cyclobutane-1,2,3,4-tetramine;tetrahydrobromide.
| Compound Name | cyclobutane-1,2,3,4-tetramine;tetrahydrobromide |
|---|---|
| PubChem CID | 12509581 |
| Molecular Formula | C4H16Br4N4 |
| Molecular Weight | 439.82 g/mol |
| Exact Mass | 435.81 |
| IUPAC Name | cyclobutane-1,2,3,4-tetramine;tetrahydrobromide |
| SMILES | Br.Br.Br.Br.NC1C(N)C(N)C1N |
| InChI | InChI=1S/C4H12N4.4BrH/c5-1-2(6)4(8)3(1)7;;;;/h1-4H,5-8H2;4*1H |
| InChIKey | JQQNXEKEGSXREI-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.82 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |