C7H21N7 — CID 59073254
cycloheptane-1,2,3,4,5,6,7-heptamine (PubChem CID 59073254) has the molecular formula C7H21N7 and a molecular weight of 203.29 g/mol. Its IUPAC name is cycloheptane-1,2,3,4,5,6,7-heptamine.
| Compound Name | cycloheptane-1,2,3,4,5,6,7-heptamine |
|---|---|
| PubChem CID | 59073254 |
| Molecular Formula | C7H21N7 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | cycloheptane-1,2,3,4,5,6,7-heptamine |
| SMILES | NC1C(N)C(N)C(N)C(N)C(N)C1N |
| InChI | InChI=1S/C7H21N7/c8-1-2(9)4(11)6(13)7(14)5(12)3(1)10/h1-7H,8-14H2 |
| InChIKey | NHTYMSZZJNFLDS-UHFFFAOYSA-N |
| XLogP | -4.71 |
| TPSA | 182.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |