C11H12N2O — CID 98459403
(E)-3-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-cyanoprop-2-enamide (PubChem CID 98459403) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is (E)-3-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 98459403 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (E)-3-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\[C@@H]1C[C@@H]2C=C[C@@H]1C2)C(N)=O |
| InChI | InChI=1S/C11H12N2O/c12-6-10(11(13)14)5-9-4-7-1-2-8(9)3-7/h1-2,5,7-9H,3-4H2,(H2,13,14)/b10-5+/t7-,8-,9+/m1/s1 |
| InChIKey | IPNONMLKDJECAE-HXNNWHEPSA-N |
| XLogP | 1.13 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|