C9H10O — CID 134893122
2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethenone (PubChem CID 134893122) has the molecular formula C9H10O and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethenone.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethenone |
|---|---|
| PubChem CID | 134893122 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethenone |
| SMILES | O=C=C[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H10O/c10-4-3-9-6-7-1-2-8(9)5-7/h1-3,7-9H,5-6H2/t7-,8+,9-/m0/s1 |
| InChIKey | PCKJQJJVXDTONN-YIZRAAEISA-N |
| XLogP | 1.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|