C18H26O9 — CID 98511375
(1R,3R,4R,6R,9S)-9-methyl-4-[[(1R,3S,4S,6S,9S)-9-methyl-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecan-4-yl]methoxymethyl]-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecane (PubChem CID 98511375) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is (1R,3R,4R,6R,9S)-9-methyl-4-[[(1R,3S,4S,6S,9S)-9-methyl-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecan-4-yl]methoxymethyl]-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecane.
| Compound Name | (1R,3R,4R,6R,9S)-9-methyl-4-[[(1R,3S,4S,6S,9S)-9-methyl-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecan-4-yl]methoxymethyl]-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecane |
|---|---|
| PubChem CID | 98511375 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (1R,3R,4R,6R,9S)-9-methyl-4-[[(1R,3S,4S,6S,9S)-9-methyl-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecan-4-yl]methoxymethyl]-2,5,8,10-tetraoxatricyclo[4.4.1.01,3]undecane |
| SMILES | C[C@H]1OC[C@H]2C[C@]3(O1)O[C@@H]3[C@@H](COC[C@@H]1O[C@@H]3CO[C@H](C)O[C@@]4(C3)O[C@@H]14)O2 |
| InChI | InChI=1S/C18H26O9/c1-9-20-5-11-3-17(24-9)15(26-17)13(22-11)7-19-8-14-16-18(27-16)4-12(23-14)6-21-10(2)25-18/h9-16H,3-8H2,1-2H3/t9-,10-,11-,12+,13-,14+,15-,16+,17-,18-/m0/s1 |
| InChIKey | NUCSHLRWJDVAOL-LYQITLDUSA-N |
| XLogP | 0.29 |
| TPSA | 89.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|