C18H24N2O3S — CID 98512356
(4S)-3-[(Z)-4-(2-methoxyphenyl)-3-methylbut-2-enoyl]-N,N-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 98512356) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is (4S)-3-[(Z)-4-(2-methoxyphenyl)-3-methylbut-2-enoyl]-N,N-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-3-[(Z)-4-(2-methoxyphenyl)-3-methylbut-2-enoyl]-N,N-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 98512356 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (4S)-3-[(Z)-4-(2-methoxyphenyl)-3-methylbut-2-enoyl]-N,N-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1ccccc1C/C(C)=C\C(=O)N1CSC[C@@H]1C(=O)N(C)C |
| InChI | InChI=1S/C18H24N2O3S/c1-13(9-14-7-5-6-8-16(14)23-4)10-17(21)20-12-24-11-15(20)18(22)19(2)3/h5-8,10,15H,9,11-12H2,1-4H3/b13-10-/t15-/m1/s1 |
| InChIKey | ZFUREVQSAYQJOX-VSKPTYQZSA-N |
| XLogP | 2.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|