C18H14Cl6 — CID 98512498
(1R,2R,3S,6S,7R,8S,9R)-3,4,5,6,12,12-hexachloro-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 98512498) has the molecular formula C18H14Cl6 and a molecular weight of 443.03 g/mol. Its IUPAC name is (1R,2R,3S,6S,7R,8S,9R)-3,4,5,6,12,12-hexachloro-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1R,2R,3S,6S,7R,8S,9R)-3,4,5,6,12,12-hexachloro-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 98512498 |
| Molecular Formula | C18H14Cl6 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 439.92 |
| IUPAC Name | (1R,2R,3S,6S,7R,8S,9R)-3,4,5,6,12,12-hexachloro-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@@H]3[C@H]4C[C@H](C[C@H]4c4ccccc4)[C@H]3[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C18H14Cl6/c19-14-15(20)17(22)13-11-7-9(12(13)16(14,21)18(17,23)24)6-10(11)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/t9-,10-,11-,12+,13+,16-,17-/m0/s1 |
| InChIKey | YHGCWRHZHLHVPR-YNRDHDQTSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|