C11H15Cl2N2O2P — CID 98533244
(2S)-N,N-bis(2-chloroethyl)-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine (PubChem CID 98533244) has the molecular formula C11H15Cl2N2O2P and a molecular weight of 309.13 g/mol. Its IUPAC name is (2S)-N,N-bis(2-chloroethyl)-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine.
| Compound Name | (2S)-N,N-bis(2-chloroethyl)-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine |
|---|---|
| PubChem CID | 98533244 |
| Molecular Formula | C11H15Cl2N2O2P |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | (2S)-N,N-bis(2-chloroethyl)-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-amine |
| SMILES | O=[P@@]1(N(CCCl)CCCl)Nc2ccccc2CO1 |
| InChI | InChI=1S/C11H15Cl2N2O2P/c12-5-7-15(8-6-13)18(16)14-11-4-2-1-3-10(11)9-17-18/h1-4H,5-9H2,(H,14,16)/t18-/m0/s1 |
| InChIKey | FHVAFBICUPKYQB-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|