C18H20N2O2S — CID 98554900
4-methyl-N-[(E)-[(1S,2E,6R,8S)-8-methyl-7-bicyclo[4.2.2]deca-2,4,9-trienylidene]amino]benzenesulfonamide (PubChem CID 98554900) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 4-methyl-N-[(E)-[(1S,2E,6R,8S)-8-methyl-7-bicyclo[4.2.2]deca-2,4,9-trienylidene]amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-[(1S,2E,6R,8S)-8-methyl-7-bicyclo[4.2.2]deca-2,4,9-trienylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 98554900 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-methyl-N-[(E)-[(1S,2E,6R,8S)-8-methyl-7-bicyclo[4.2.2]deca-2,4,9-trienylidene]amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/[C@@H]3C=C/C=C\[C@@H](C=C3)[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H20N2O2S/c1-13-7-11-17(12-8-13)23(21,22)20-19-18-14(2)15-5-3-4-6-16(18)10-9-15/h3-12,14-16,20H,1-2H3/b5-3-,6-4?,19-18+/t14-,15-,16+/m0/s1 |
| InChIKey | NJKAGWLHGKJNOV-QRNHUCKKSA-N |
| XLogP | 3.19 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|