C13H16F6N2O2 — CID 98565115
1,1,1-trifluoro-4-[(2S)-2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]propyl]iminopentan-2-one (PubChem CID 98565115) has the molecular formula C13H16F6N2O2 and a molecular weight of 346.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[(2S)-2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]propyl]iminopentan-2-one.
| Compound Name | 1,1,1-trifluoro-4-[(2S)-2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]propyl]iminopentan-2-one |
|---|---|
| PubChem CID | 98565115 |
| Molecular Formula | C13H16F6N2O2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1,1,1-trifluoro-4-[(2S)-2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]propyl]iminopentan-2-one |
| SMILES | C/C(CC(=O)C(F)(F)F)=N\C[C@H](C)/N=C(\C)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F6N2O2/c1-7(4-10(22)12(14,15)16)20-6-9(3)21-8(2)5-11(23)13(17,18)19/h9H,4-6H2,1-3H3/b20-7+,21-8+/t9-/m0/s1 |
| InChIKey | VNLNAOXDCUNKIA-MMHHRTTBSA-N |
| XLogP | 3.34 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|