C9H12F5NO — CID 7147144
1,1,1,2,2-pentafluoro-5-propan-2-yliminohexan-3-one (PubChem CID 7147144) has the molecular formula C9H12F5NO and a molecular weight of 245.19 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-5-propan-2-yliminohexan-3-one.
| Compound Name | 1,1,1,2,2-pentafluoro-5-propan-2-yliminohexan-3-one |
|---|---|
| PubChem CID | 7147144 |
| Molecular Formula | C9H12F5NO |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-5-propan-2-yliminohexan-3-one |
| SMILES | C/C(CC(=O)C(F)(F)C(F)(F)F)=N\C(C)C |
| InChI | InChI=1S/C9H12F5NO/c1-5(2)15-6(3)4-7(16)8(10,11)9(12,13)14/h5H,4H2,1-3H3/b15-6+ |
| InChIKey | XRULWFLZSUKXCK-GIDUJCDVSA-N |
| XLogP | 3.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|