C11H17N3OS2 — CID 98598396
[(Z)-4-amino-3-cyano-2-oxopent-3-enyl] N,N-diethylcarbamodithioate (PubChem CID 98598396) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] N,N-diethylcarbamodithioate.
| Compound Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 98598396 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)/C(C#N)=C(/C)N |
| InChI | InChI=1S/C11H17N3OS2/c1-4-14(5-2)11(16)17-7-10(15)9(6-12)8(3)13/h4-5,7,13H2,1-3H3/b9-8- |
| InChIKey | PKSFDRNBDKREOS-HJWRWDBZSA-N |
| XLogP | 1.67 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|