About [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate
[(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate (PubChem CID 98621035) has the molecular formula C24H29NO4
and a molecular weight of 395.50 g/mol. Its IUPAC name is [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate.
Molecular Properties
| Compound Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate |
| PubChem CID | 98621035 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@@H](C)OC(=O)CC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C24H29NO4/c1-14-21(18-5-3-4-6-19(18)25-14)22(27)15(2)29-20(26)12-23-8-16-7-17(9-23)11-24(28,10-16)13-23/h3-6,15-17,25,28H,7-13H2,1-2H3/t15-,16-,17-,23?,24?/m1/s1 |
| InChIKey | FSPBBXIGEMEVQI-QZNMPKTDSA-N |
| XLogP | 4.31 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate?
The IUPAC name of [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate (CID 98621035) is [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate.
What is the SMILES notation for [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate?
The canonical SMILES for [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate is Cc1[nH]c2ccccc2c1C(=O)[C@@H](C)OC(=O)CC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2.
What is the InChIKey of [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate?
The InChIKey is FSPBBXIGEMEVQI-QZNMPKTDSA-N. The full InChI is InChI=1S/C24H29NO4/c1-14-21(18-5-3-4-6-19(18)25-14)22(27)15(2)29-20(26)12-23-8-16-7-17(9-23)11-24(28,10-16)13-23/h3-6,15-17,25,28H,7-13H2,1-2H3/t15-,16-,17-,23?,24?/m1/s1.
What are the key properties of [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate?
[(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate has a molecular weight of 395.50 g/mol, XLogP of 4.31, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate is sourced from PubChem (CID 98621035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).