C17H17NO2S — CID 98727525
[4-(1,3-thiazol-2-yl)phenyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 98727525) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is [4-(1,3-thiazol-2-yl)phenyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [4-(1,3-thiazol-2-yl)phenyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 98727525 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [4-(1,3-thiazol-2-yl)phenyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(Oc1ccc(-c2nccs2)cc1)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H17NO2S/c19-17(15-10-11-1-2-13(15)9-11)20-14-5-3-12(4-6-14)16-18-7-8-21-16/h3-8,11,13,15H,1-2,9-10H2/t11-,13-,15-/m0/s1 |
| InChIKey | LIXLIDGNOBKXMP-WHOFXGATSA-N |
| XLogP | 4.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|