C24H36N2O4 — CID 98734913
(2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol (PubChem CID 98734913) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is (2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol.
| Compound Name | (2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 98734913 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]propan-2-ol |
| SMILES | O[C@@H](COCC[C@H]1C[C@H]2CC[C@H]1C2)CN1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H36N2O4/c27-22(16-28-10-5-21-12-18-1-3-20(21)11-18)15-26-8-6-25(7-9-26)14-19-2-4-23-24(13-19)30-17-29-23/h2,4,13,18,20-22,27H,1,3,5-12,14-17H2/t18-,20-,21-,22+/m0/s1 |
| InChIKey | WTVCCFYXFAGTJX-JKLQHZFJSA-N |
| XLogP | 2.74 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|