C20H29N3O2 — CID 98759153
[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2S)-1-(pyridin-4-ylmethyl)piperidin-2-yl]methanone (PubChem CID 98759153) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is [(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2S)-1-(pyridin-4-ylmethyl)piperidin-2-yl]methanone.
| Compound Name | [(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2S)-1-(pyridin-4-ylmethyl)piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 98759153 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | [(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2S)-1-(pyridin-4-ylmethyl)piperidin-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCCN1Cc1ccncc1)N1CCO[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H29N3O2/c24-20(23-13-14-25-19-7-2-1-5-17(19)23)18-6-3-4-12-22(18)15-16-8-10-21-11-9-16/h8-11,17-19H,1-7,12-15H2/t17-,18-,19+/m0/s1 |
| InChIKey | YGHFHCNSKKSSFV-GBESFXJTSA-N |
| XLogP | 2.61 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |