C19H28N2O4S — CID 98760739
methyl (2S,3aS,7aS)-1-[[2-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 98760739) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is methyl (2S,3aS,7aS)-1-[[2-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aS,7aS)-1-[[2-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 98760739 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl (2S,3aS,7aS)-1-[[2-(2-oxo-2-propan-2-yloxyethyl)-1,3-thiazol-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1Cc1csc(CC(=O)OC(C)C)n1 |
| InChI | InChI=1S/C19H28N2O4S/c1-12(2)25-18(22)9-17-20-14(11-26-17)10-21-15-7-5-4-6-13(15)8-16(21)19(23)24-3/h11-13,15-16H,4-10H2,1-3H3/t13-,15-,16-/m0/s1 |
| InChIKey | XUPGOTOJGGVQEP-BPUTZDHNSA-N |
| XLogP | 2.94 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |