C19H26N4O3 — CID 98800788
(5S)-N-[(1S,2R)-2-(hydroxymethyl)cycloheptyl]-5-methyl-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide (PubChem CID 98800788) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (5S)-N-[(1S,2R)-2-(hydroxymethyl)cycloheptyl]-5-methyl-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide.
| Compound Name | (5S)-N-[(1S,2R)-2-(hydroxymethyl)cycloheptyl]-5-methyl-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide |
|---|---|
| PubChem CID | 98800788 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (5S)-N-[(1S,2R)-2-(hydroxymethyl)cycloheptyl]-5-methyl-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxamide |
| SMILES | C[C@@H]1N=C(C(=O)N[C@H]2CCCCC[C@H]2CO)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H26N4O3/c1-13-19(26)23(15-9-5-3-6-10-15)22-17(20-13)18(25)21-16-11-7-2-4-8-14(16)12-24/h3,5-6,9-10,13-14,16,24H,2,4,7-8,11-12H2,1H3,(H,20,22)(H,21,25)/t13-,14-,16-/m0/s1 |
| InChIKey | AYEUOORFKUQZBW-DZKIICNBSA-N |
| XLogP | 1.38 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |