C35H45N3O6 — CID 98885533
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylpentanamide (PubChem CID 98885533) has the molecular formula C35H45N3O6 and a molecular weight of 603.76 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 98885533 |
| Molecular Formula | C35H45N3O6 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylpentanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@@H](CC(C)C)C(=O)NC[C@H]3C[C@H]4C=C[C@H]3C4)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C35H45N3O6/c1-19(2)13-29(35(41)36-18-24-15-21-7-8-22(24)14-21)38-28-12-10-25-26(17-30(28)40)27(37-20(3)39)11-9-23-16-31(42-4)33(43-5)34(44-6)32(23)25/h7-8,10,12,16-17,19,21-22,24,27,29H,9,11,13-15,18H2,1-6H3,(H,36,41)(H,37,39)(H,38,40)/t21-,22-,24+,27-,29-/m0/s1 |
| InChIKey | SPDNDSIWUKVGAP-CWIYRCGUSA-N |
| XLogP | 5.02 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|