About 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide
6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide (PubChem CID 98893292) has the molecular formula C13H17N5O2
and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide |
| PubChem CID | 98893292 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide |
| SMILES | CC1(C)C[C@H](NC(=O)c2ccc(N=[N+]=[N-])nc2)CCO1 |
| InChI | InChI=1S/C13H17N5O2/c1-13(2)7-10(5-6-20-13)16-12(19)9-3-4-11(15-8-9)17-18-14/h3-4,8,10H,5-7H2,1-2H3,(H,16,19)/t10-/m1/s1 |
| InChIKey | LYUCWPQFFOFDHY-SNVBAGLBSA-N |
| XLogP | 2.71 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide?
The IUPAC name of 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide (CID 98893292) is 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide.
What is the SMILES notation for 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide?
The canonical SMILES for 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide is CC1(C)C[C@H](NC(=O)c2ccc(N=[N+]=[N-])nc2)CCO1.
What is the InChIKey of 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide?
The InChIKey is LYUCWPQFFOFDHY-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H17N5O2/c1-13(2)7-10(5-6-20-13)16-12(19)9-3-4-11(15-8-9)17-18-14/h3-4,8,10H,5-7H2,1-2H3,(H,16,19)/t10-/m1/s1.
What are the key properties of 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide?
6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide has a molecular weight of 275.31 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azido-N-[(4R)-2,2-dimethyloxan-4-yl]pyridine-3-carboxamide is sourced from PubChem (CID 98893292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).