C14H26N2O3 — CID 99108108
1-[(1R,2R)-2-methoxycycloheptyl]-3-[(3S)-3-methyloxolan-3-yl]urea (PubChem CID 99108108) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methoxycycloheptyl]-3-[(3S)-3-methyloxolan-3-yl]urea.
| Compound Name | 1-[(1R,2R)-2-methoxycycloheptyl]-3-[(3S)-3-methyloxolan-3-yl]urea |
|---|---|
| PubChem CID | 99108108 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-[(1R,2R)-2-methoxycycloheptyl]-3-[(3S)-3-methyloxolan-3-yl]urea |
| SMILES | CO[C@@H]1CCCCC[C@H]1NC(=O)N[C@@]1(C)CCOC1 |
| InChI | InChI=1S/C14H26N2O3/c1-14(8-9-19-10-14)16-13(17)15-11-6-4-3-5-7-12(11)18-2/h11-12H,3-10H2,1-2H3,(H2,15,16,17)/t11-,12-,14+/m1/s1 |
| InChIKey | IVYMBCBIXZRTLX-BZPMIXESSA-N |
| XLogP | 1.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |