C25H24N2O3S — CID 99130099
(3aS,7aR)-2-[4-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylphenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 99130099) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is (3aS,7aR)-2-[4-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylphenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[4-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylphenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 99130099 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (3aS,7aR)-2-[4-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylphenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C[C@@H](Sc1ccc(N2C(=O)[C@H]3CC=CC[C@H]3C2=O)cc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C25H24N2O3S/c1-16(23(28)26-15-14-17-6-2-5-9-22(17)26)31-19-12-10-18(11-13-19)27-24(29)20-7-3-4-8-21(20)25(27)30/h2-6,9-13,16,20-21H,7-8,14-15H2,1H3/t16-,20-,21+/m1/s1 |
| InChIKey | AKIVDBMJSGATEX-HBGVWJBISA-N |
| XLogP | 4.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|