C20H24BrF2N3O3 — CID 99150136
(E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 99150136) has the molecular formula C20H24BrF2N3O3 and a molecular weight of 472.33 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 99150136 |
| Molecular Formula | C20H24BrF2N3O3 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)ccc1OC(F)F)N1CCN(CC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H24BrF2N3O3/c21-16-4-5-17(29-20(22)23)15(13-16)3-6-18(27)26-11-9-24(10-12-26)14-19(28)25-7-1-2-8-25/h3-6,13,20H,1-2,7-12,14H2/b6-3+ |
| InChIKey | KABWYXFQJXQYED-ZZXKWVIFSA-N |
| XLogP | 2.83 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|