C16H22N2O3S — CID 9953
1-cyclohexyl-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)urea (PubChem CID 9953) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)urea.
| Compound Name | 1-cyclohexyl-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)urea |
|---|---|
| PubChem CID | 9953 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-cyclohexyl-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)urea |
| SMILES | O=C(NC1CCCCC1)NS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H22N2O3S/c19-16(17-14-7-2-1-3-8-14)18-22(20,21)15-10-9-12-5-4-6-13(12)11-15/h9-11,14H,1-8H2,(H2,17,18,19) |
| InChIKey | NFRPNQDSKJJQGV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |