C10H8BrNO2 — CID 99563949
(3R,4S)-3-bromo-4-phenylpyrrolidine-2,5-dione (PubChem CID 99563949) has the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. Its IUPAC name is (3R,4S)-3-bromo-4-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R,4S)-3-bromo-4-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 99563949 |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | (3R,4S)-3-bromo-4-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)[C@H](Br)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H8BrNO2/c11-8-7(9(13)12-10(8)14)6-4-2-1-3-5-6/h1-5,7-8H,(H,12,13,14)/t7-,8-/m1/s1 |
| InChIKey | QOLORTABSNRPHO-HTQZYQBOSA-N |
| XLogP | 1.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|