C10H5BrCl2FNO2 — CID 107581138
3-bromo-4-(3,5-dichloro-4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 107581138) has the molecular formula C10H5BrCl2FNO2 and a molecular weight of 340.96 g/mol. Its IUPAC name is 3-bromo-4-(3,5-dichloro-4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-bromo-4-(3,5-dichloro-4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 107581138 |
| Molecular Formula | C10H5BrCl2FNO2 |
| Molecular Weight | 340.96 g/mol |
| Exact Mass | 338.89 |
| IUPAC Name | 3-bromo-4-(3,5-dichloro-4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cc(Cl)c(F)c(Cl)c2)C1Br |
| InChI | InChI=1S/C10H5BrCl2FNO2/c11-7-6(9(16)15-10(7)17)3-1-4(12)8(14)5(13)2-3/h1-2,6-7H,(H,15,16,17) |
| InChIKey | PKSMZJTUWZRSIG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.96 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|