C22H18N2OS — CID 40634429
(5R,6S)-1,5,6-triphenyl-2-sulfanylidene-1,3-diazinan-4-one (PubChem CID 40634429) has the molecular formula C22H18N2OS and a molecular weight of 358.47 g/mol. Its IUPAC name is (5R,6S)-1,5,6-triphenyl-2-sulfanylidene-1,3-diazinan-4-one.
| Compound Name | (5R,6S)-1,5,6-triphenyl-2-sulfanylidene-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 40634429 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (5R,6S)-1,5,6-triphenyl-2-sulfanylidene-1,3-diazinan-4-one |
| SMILES | O=C1NC(=S)N(c2ccccc2)[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H18N2OS/c25-21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)24(22(26)23-21)18-14-8-3-9-15-18/h1-15,19-20H,(H,23,25,26)/t19-,20-/m1/s1 |
| InChIKey | YCICIEWNENOAKE-WOJBJXKFSA-N |
| XLogP | 4.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|