C24H33NO5S2 — CID 99569240
2-[[2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylcarbothioylamino]acetic acid (PubChem CID 99569240) has the molecular formula C24H33NO5S2 and a molecular weight of 479.66 g/mol. Its IUPAC name is 2-[[2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylcarbothioylamino]acetic acid.
| Compound Name | 2-[[2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylcarbothioylamino]acetic acid |
|---|---|
| PubChem CID | 99569240 |
| Molecular Formula | C24H33NO5S2 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[[2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylcarbothioylamino]acetic acid |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CSC(=S)NCC(=O)O |
| InChI | InChI=1S/C24H33NO5S2/c1-22-8-5-15(26)11-14(22)3-4-16-17(22)6-9-23(2)18(16)7-10-24(23,30)19(27)13-32-21(31)25-12-20(28)29/h11,16-18,30H,3-10,12-13H2,1-2H3,(H,25,31)(H,28,29)/t16-,17+,18+,22+,23+,24+/m1/s1 |
| InChIKey | WJZAIXAIFJQAJF-PHELPCDKSA-N |
| XLogP | 3.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|